C16H15F3N2O3S2 — CID 50777672
4-(pyrrolidine-1-carbonyl)-N-[4-(trifluoromethyl)phenyl]thiophene-2-sulfonamide (PubChem CID 50777672) has the molecular formula C16H15F3N2O3S2 and a molecular weight of 404.44 g/mol. Its IUPAC name is 4-(pyrrolidine-1-carbonyl)-N-[4-(trifluoromethyl)phenyl]thiophene-2-sulfonamide.
| Compound Name | 4-(pyrrolidine-1-carbonyl)-N-[4-(trifluoromethyl)phenyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 50777672 |
| Molecular Formula | C16H15F3N2O3S2 |
| Molecular Weight | 404.44 g/mol |
| Exact Mass | 404.05 |
| IUPAC Name | 4-(pyrrolidine-1-carbonyl)-N-[4-(trifluoromethyl)phenyl]thiophene-2-sulfonamide |
| SMILES | O=C(c1csc(S(=O)(=O)Nc2ccc(C(F)(F)F)cc2)c1)N1CCCC1 |
| InChI | InChI=1S/C16H15F3N2O3S2/c17-16(18,19)12-3-5-13(6-4-12)20-26(23,24)14-9-11(10-25-14)15(22)21-7-1-2-8-21/h3-6,9-10,20H,1-2,7-8H2 |
| InChIKey | JLUKOAFDVPAQFE-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.44 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |