C16H11F3N2O4S2 — CID 56556507
5-[[2-pyrrol-1-yl-5-(trifluoromethyl)phenyl]sulfamoyl]thiophene-3-carboxylic acid (PubChem CID 56556507) has the molecular formula C16H11F3N2O4S2 and a molecular weight of 416.40 g/mol. Its IUPAC name is 5-[[2-pyrrol-1-yl-5-(trifluoromethyl)phenyl]sulfamoyl]thiophene-3-carboxylic acid.
| Compound Name | 5-[[2-pyrrol-1-yl-5-(trifluoromethyl)phenyl]sulfamoyl]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 56556507 |
| Molecular Formula | C16H11F3N2O4S2 |
| Molecular Weight | 416.40 g/mol |
| Exact Mass | 416.01 |
| IUPAC Name | 5-[[2-pyrrol-1-yl-5-(trifluoromethyl)phenyl]sulfamoyl]thiophene-3-carboxylic acid |
| SMILES | O=C(O)c1csc(S(=O)(=O)Nc2cc(C(F)(F)F)ccc2-n2cccc2)c1 |
| InChI | InChI=1S/C16H11F3N2O4S2/c17-16(18,19)11-3-4-13(21-5-1-2-6-21)12(8-11)20-27(24,25)14-7-10(9-26-14)15(22)23/h1-9,20H,(H,22,23) |
| InChIKey | HIAKRWWTRNCPSS-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 88.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.40 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfonamide_J(1)', 'substructure': 'N/A'} |
|---|