C22H25N3O2 — CID 50779889
N-(4-ethylphenyl)-6,7-dimethyl-3-propoxyquinoxaline-2-carboxamide (PubChem CID 50779889) has the molecular formula C22H25N3O2 and a molecular weight of 363.46 g/mol. Its IUPAC name is N-(4-ethylphenyl)-6,7-dimethyl-3-propoxyquinoxaline-2-carboxamide.
| Compound Name | N-(4-ethylphenyl)-6,7-dimethyl-3-propoxyquinoxaline-2-carboxamide |
|---|---|
| PubChem CID | 50779889 |
| Molecular Formula | C22H25N3O2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | N-(4-ethylphenyl)-6,7-dimethyl-3-propoxyquinoxaline-2-carboxamide |
| SMILES | CCCOc1nc2cc(C)c(C)cc2nc1C(=O)Nc1ccc(CC)cc1 |
| InChI | InChI=1S/C22H25N3O2/c1-5-11-27-22-20(21(26)23-17-9-7-16(6-2)8-10-17)24-18-12-14(3)15(4)13-19(18)25-22/h7-10,12-13H,5-6,11H2,1-4H3,(H,23,26) |
| InChIKey | AYMGTVLMOCRFLU-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |