C19H19N3O2 — CID 50780048
3-methoxy-6,7-dimethyl-N-(4-methylphenyl)quinoxaline-2-carboxamide (PubChem CID 50780048) has the molecular formula C19H19N3O2 and a molecular weight of 321.38 g/mol. Its IUPAC name is 3-methoxy-6,7-dimethyl-N-(4-methylphenyl)quinoxaline-2-carboxamide.
| Compound Name | 3-methoxy-6,7-dimethyl-N-(4-methylphenyl)quinoxaline-2-carboxamide |
|---|---|
| PubChem CID | 50780048 |
| Molecular Formula | C19H19N3O2 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | 3-methoxy-6,7-dimethyl-N-(4-methylphenyl)quinoxaline-2-carboxamide |
| SMILES | COc1nc2cc(C)c(C)cc2nc1C(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C19H19N3O2/c1-11-5-7-14(8-6-11)20-18(23)17-19(24-4)22-16-10-13(3)12(2)9-15(16)21-17/h5-10H,1-4H3,(H,20,23) |
| InChIKey | NFDXMARYUYHAAE-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |