C23H29N3O4 — CID 50781795
5-[4-(2-ethoxyphenyl)piperazin-1-yl]-2-(2-methylpropanoylamino)benzoic acid (PubChem CID 50781795) has the molecular formula C23H29N3O4 and a molecular weight of 411.50 g/mol. Its IUPAC name is 5-[4-(2-ethoxyphenyl)piperazin-1-yl]-2-(2-methylpropanoylamino)benzoic acid.
| Compound Name | 5-[4-(2-ethoxyphenyl)piperazin-1-yl]-2-(2-methylpropanoylamino)benzoic acid |
|---|---|
| PubChem CID | 50781795 |
| Molecular Formula | C23H29N3O4 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | 5-[4-(2-ethoxyphenyl)piperazin-1-yl]-2-(2-methylpropanoylamino)benzoic acid |
| SMILES | CCOc1ccccc1N1CCN(c2ccc(NC(=O)C(C)C)c(C(=O)O)c2)CC1 |
| InChI | InChI=1S/C23H29N3O4/c1-4-30-21-8-6-5-7-20(21)26-13-11-25(12-14-26)17-9-10-19(18(15-17)23(28)29)24-22(27)16(2)3/h5-10,15-16H,4,11-14H2,1-3H3,(H,24,27)(H,28,29) |
| InChIKey | AAOPENNWTGAKKC-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |