C26H32N4O5 — CID 50782411
5-[4-(2-oxo-2-piperidin-1-ylethyl)piperazin-1-yl]-2-[(2-phenoxyacetyl)amino]benzoic acid (PubChem CID 50782411) has the molecular formula C26H32N4O5 and a molecular weight of 480.57 g/mol. Its IUPAC name is 5-[4-(2-oxo-2-piperidin-1-ylethyl)piperazin-1-yl]-2-[(2-phenoxyacetyl)amino]benzoic acid.
| Compound Name | 5-[4-(2-oxo-2-piperidin-1-ylethyl)piperazin-1-yl]-2-[(2-phenoxyacetyl)amino]benzoic acid |
|---|---|
| PubChem CID | 50782411 |
| Molecular Formula | C26H32N4O5 |
| Molecular Weight | 480.57 g/mol |
| Exact Mass | 480.24 |
| IUPAC Name | 5-[4-(2-oxo-2-piperidin-1-ylethyl)piperazin-1-yl]-2-[(2-phenoxyacetyl)amino]benzoic acid |
| SMILES | O=C(COc1ccccc1)Nc1ccc(N2CCN(CC(=O)N3CCCCC3)CC2)cc1C(=O)O |
| InChI | InChI=1S/C26H32N4O5/c31-24(19-35-21-7-3-1-4-8-21)27-23-10-9-20(17-22(23)26(33)34)29-15-13-28(14-16-29)18-25(32)30-11-5-2-6-12-30/h1,3-4,7-10,17H,2,5-6,11-16,18-19H2,(H,27,31)(H,33,34) |
| InChIKey | NMTYEHMHHUQKQO-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.57 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |