C27H34N4O4 — CID 50781901
5-[4-[2-(azepan-1-yl)-2-oxoethyl]piperazin-1-yl]-2-[(4-methylbenzoyl)amino]benzoic acid (PubChem CID 50781901) has the molecular formula C27H34N4O4 and a molecular weight of 478.59 g/mol. Its IUPAC name is 5-[4-[2-(azepan-1-yl)-2-oxoethyl]piperazin-1-yl]-2-[(4-methylbenzoyl)amino]benzoic acid.
| Compound Name | 5-[4-[2-(azepan-1-yl)-2-oxoethyl]piperazin-1-yl]-2-[(4-methylbenzoyl)amino]benzoic acid |
|---|---|
| PubChem CID | 50781901 |
| Molecular Formula | C27H34N4O4 |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.26 |
| IUPAC Name | 5-[4-[2-(azepan-1-yl)-2-oxoethyl]piperazin-1-yl]-2-[(4-methylbenzoyl)amino]benzoic acid |
| SMILES | Cc1ccc(C(=O)Nc2ccc(N3CCN(CC(=O)N4CCCCCC4)CC3)cc2C(=O)O)cc1 |
| InChI | InChI=1S/C27H34N4O4/c1-20-6-8-21(9-7-20)26(33)28-24-11-10-22(18-23(24)27(34)35)30-16-14-29(15-17-30)19-25(32)31-12-4-2-3-5-13-31/h6-11,18H,2-5,12-17,19H2,1H3,(H,28,33)(H,34,35) |
| InChIKey | DAVZJBJDUYTYFI-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 93.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |