C24H29ClN4O5 — CID 50781865
2-[(4-chlorobenzoyl)amino]-5-[4-[2-(3-methoxypropylamino)-2-oxoethyl]piperazin-1-yl]benzoic acid (PubChem CID 50781865) has the molecular formula C24H29ClN4O5 and a molecular weight of 488.97 g/mol. Its IUPAC name is 2-[(4-chlorobenzoyl)amino]-5-[4-[2-(3-methoxypropylamino)-2-oxoethyl]piperazin-1-yl]benzoic acid.
| Compound Name | 2-[(4-chlorobenzoyl)amino]-5-[4-[2-(3-methoxypropylamino)-2-oxoethyl]piperazin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 50781865 |
| Molecular Formula | C24H29ClN4O5 |
| Molecular Weight | 488.97 g/mol |
| Exact Mass | 488.18 |
| IUPAC Name | 2-[(4-chlorobenzoyl)amino]-5-[4-[2-(3-methoxypropylamino)-2-oxoethyl]piperazin-1-yl]benzoic acid |
| SMILES | COCCCNC(=O)CN1CCN(c2ccc(NC(=O)c3ccc(Cl)cc3)c(C(=O)O)c2)CC1 |
| InChI | InChI=1S/C24H29ClN4O5/c1-34-14-2-9-26-22(30)16-28-10-12-29(13-11-28)19-7-8-21(20(15-19)24(32)33)27-23(31)17-3-5-18(25)6-4-17/h3-8,15H,2,9-14,16H2,1H3,(H,26,30)(H,27,31)(H,32,33) |
| InChIKey | ZCZDZOGOWCMZRH-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 111.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.97 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|