C20H20ClN3O4 — CID 50782912
5-(4-carbamoylpiperidin-1-yl)-2-[(4-chlorobenzoyl)amino]benzoic acid (PubChem CID 50782912) has the molecular formula C20H20ClN3O4 and a molecular weight of 401.85 g/mol. Its IUPAC name is 5-(4-carbamoylpiperidin-1-yl)-2-[(4-chlorobenzoyl)amino]benzoic acid.
| Compound Name | 5-(4-carbamoylpiperidin-1-yl)-2-[(4-chlorobenzoyl)amino]benzoic acid |
|---|---|
| PubChem CID | 50782912 |
| Molecular Formula | C20H20ClN3O4 |
| Molecular Weight | 401.85 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | 5-(4-carbamoylpiperidin-1-yl)-2-[(4-chlorobenzoyl)amino]benzoic acid |
| SMILES | NC(=O)C1CCN(c2ccc(NC(=O)c3ccc(Cl)cc3)c(C(=O)O)c2)CC1 |
| InChI | InChI=1S/C20H20ClN3O4/c21-14-3-1-13(2-4-14)19(26)23-17-6-5-15(11-16(17)20(27)28)24-9-7-12(8-10-24)18(22)25/h1-6,11-12H,7-10H2,(H2,22,25)(H,23,26)(H,27,28) |
| InChIKey | AQOVYFRGZPWBEX-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.85 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |