C16H22N2O3 — CID 50782783
5-[butyl(methyl)amino]-2-(cyclopropanecarbonylamino)benzoic acid (PubChem CID 50782783) has the molecular formula C16H22N2O3 and a molecular weight of 290.36 g/mol. Its IUPAC name is 5-[butyl(methyl)amino]-2-(cyclopropanecarbonylamino)benzoic acid.
| Compound Name | 5-[butyl(methyl)amino]-2-(cyclopropanecarbonylamino)benzoic acid |
|---|---|
| PubChem CID | 50782783 |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | 5-[butyl(methyl)amino]-2-(cyclopropanecarbonylamino)benzoic acid |
| SMILES | CCCCN(C)c1ccc(NC(=O)C2CC2)c(C(=O)O)c1 |
| InChI | InChI=1S/C16H22N2O3/c1-3-4-9-18(2)12-7-8-14(13(10-12)16(20)21)17-15(19)11-5-6-11/h7-8,10-11H,3-6,9H2,1-2H3,(H,17,19)(H,20,21) |
| InChIKey | PGOSZLHJMFXOHN-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |