C22H23N5O4S2 — CID 50785663
methyl 4-[[2-[[8-(3-methylbutyl)-7-oxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-12-yl]sulfanyl]acetyl]amino]benzoate (PubChem CID 50785663) has the molecular formula C22H23N5O4S2 and a molecular weight of 485.59 g/mol. Its IUPAC name is methyl 4-[[2-[[8-(3-methylbutyl)-7-oxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-12-yl]sulfanyl]acetyl]amino]benzoate.
| Compound Name | methyl 4-[[2-[[8-(3-methylbutyl)-7-oxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-12-yl]sulfanyl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 50785663 |
| Molecular Formula | C22H23N5O4S2 |
| Molecular Weight | 485.59 g/mol |
| Exact Mass | 485.12 |
| IUPAC Name | methyl 4-[[2-[[8-(3-methylbutyl)-7-oxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-12-yl]sulfanyl]acetyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)CSc2nnc3n(CCC(C)C)c(=O)c4sccc4n23)cc1 |
| InChI | InChI=1S/C22H23N5O4S2/c1-13(2)8-10-26-19(29)18-16(9-11-32-18)27-21(26)24-25-22(27)33-12-17(28)23-15-6-4-14(5-7-15)20(30)31-3/h4-7,9,11,13H,8,10,12H2,1-3H3,(H,23,28) |
| InChIKey | RKBPYHGWLBWLAA-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 107.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.59 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |