C22H25N5O3S2 — CID 50785685
N-(4-ethoxyphenyl)-2-[[8-(3-methylbutyl)-7-oxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-12-yl]sulfanyl]acetamide (PubChem CID 50785685) has the molecular formula C22H25N5O3S2 and a molecular weight of 471.61 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-2-[[8-(3-methylbutyl)-7-oxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-12-yl]sulfanyl]acetamide.
| Compound Name | N-(4-ethoxyphenyl)-2-[[8-(3-methylbutyl)-7-oxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-12-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 50785685 |
| Molecular Formula | C22H25N5O3S2 |
| Molecular Weight | 471.61 g/mol |
| Exact Mass | 471.14 |
| IUPAC Name | N-(4-ethoxyphenyl)-2-[[8-(3-methylbutyl)-7-oxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-12-yl]sulfanyl]acetamide |
| SMILES | CCOc1ccc(NC(=O)CSc2nnc3n(CCC(C)C)c(=O)c4sccc4n23)cc1 |
| InChI | InChI=1S/C22H25N5O3S2/c1-4-30-16-7-5-15(6-8-16)23-18(28)13-32-22-25-24-21-26(11-9-14(2)3)20(29)19-17(27(21)22)10-12-31-19/h5-8,10,12,14H,4,9,11,13H2,1-3H3,(H,23,28) |
| InChIKey | WEAVCDRBBVTETN-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 90.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.61 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |