C19H29N5O3S — CID 50787500
N-butyl-1-(1-propan-2-ylbenzotriazol-5-yl)sulfonylpiperidine-3-carboxamide (PubChem CID 50787500) has the molecular formula C19H29N5O3S and a molecular weight of 407.54 g/mol. Its IUPAC name is N-butyl-1-(1-propan-2-ylbenzotriazol-5-yl)sulfonylpiperidine-3-carboxamide.
| Compound Name | N-butyl-1-(1-propan-2-ylbenzotriazol-5-yl)sulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 50787500 |
| Molecular Formula | C19H29N5O3S |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | N-butyl-1-(1-propan-2-ylbenzotriazol-5-yl)sulfonylpiperidine-3-carboxamide |
| SMILES | CCCCNC(=O)C1CCCN(S(=O)(=O)c2ccc3c(c2)nnn3C(C)C)C1 |
| InChI | InChI=1S/C19H29N5O3S/c1-4-5-10-20-19(25)15-7-6-11-23(13-15)28(26,27)16-8-9-18-17(12-16)21-22-24(18)14(2)3/h8-9,12,14-15H,4-7,10-11,13H2,1-3H3,(H,20,25) |
| InChIKey | VGWVFIHAOKSARH-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|