C22H36N6O3S — CID 50787540
N-[3-(diethylamino)propyl]-1-(1-propan-2-ylbenzotriazol-5-yl)sulfonylpiperidine-3-carboxamide (PubChem CID 50787540) has the molecular formula C22H36N6O3S and a molecular weight of 464.64 g/mol. Its IUPAC name is N-[3-(diethylamino)propyl]-1-(1-propan-2-ylbenzotriazol-5-yl)sulfonylpiperidine-3-carboxamide.
| Compound Name | N-[3-(diethylamino)propyl]-1-(1-propan-2-ylbenzotriazol-5-yl)sulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 50787540 |
| Molecular Formula | C22H36N6O3S |
| Molecular Weight | 464.64 g/mol |
| Exact Mass | 464.26 |
| IUPAC Name | N-[3-(diethylamino)propyl]-1-(1-propan-2-ylbenzotriazol-5-yl)sulfonylpiperidine-3-carboxamide |
| SMILES | CCN(CC)CCCNC(=O)C1CCCN(S(=O)(=O)c2ccc3c(c2)nnn3C(C)C)C1 |
| InChI | InChI=1S/C22H36N6O3S/c1-5-26(6-2)13-8-12-23-22(29)18-9-7-14-27(16-18)32(30,31)19-10-11-21-20(15-19)24-25-28(21)17(3)4/h10-11,15,17-18H,5-9,12-14,16H2,1-4H3,(H,23,29) |
| InChIKey | MZJIHJNJABHXSD-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 100.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.64 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|