C28H28N2O4S — CID 50790852
4-[[4-methyl-5-(4-methylphenyl)-1,1,3-trioxo-1,2-thiazol-2-yl]methyl]-N-(3-phenylpropyl)benzamide (PubChem CID 50790852) has the molecular formula C28H28N2O4S and a molecular weight of 488.61 g/mol. Its IUPAC name is 4-[[4-methyl-5-(4-methylphenyl)-1,1,3-trioxo-1,2-thiazol-2-yl]methyl]-N-(3-phenylpropyl)benzamide.
| Compound Name | 4-[[4-methyl-5-(4-methylphenyl)-1,1,3-trioxo-1,2-thiazol-2-yl]methyl]-N-(3-phenylpropyl)benzamide |
|---|---|
| PubChem CID | 50790852 |
| Molecular Formula | C28H28N2O4S |
| Molecular Weight | 488.61 g/mol |
| Exact Mass | 488.18 |
| IUPAC Name | 4-[[4-methyl-5-(4-methylphenyl)-1,1,3-trioxo-1,2-thiazol-2-yl]methyl]-N-(3-phenylpropyl)benzamide |
| SMILES | CC1=C(c2ccc(C)cc2)S(=O)(=O)N(Cc2ccc(C(=O)NCCCc3ccccc3)cc2)C1=O |
| InChI | InChI=1S/C28H28N2O4S/c1-20-10-14-24(15-11-20)26-21(2)28(32)30(35(26,33)34)19-23-12-16-25(17-13-23)27(31)29-18-6-9-22-7-4-3-5-8-22/h3-5,7-8,10-17H,6,9,18-19H2,1-2H3,(H,29,31) |
| InChIKey | KGGLXKXVJYCHNE-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.61 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|