C24H28N2O4S — CID 50790898
2-[4-methyl-1,1,3-trioxo-5-(4-propan-2-ylphenyl)-1,2-thiazol-2-yl]-N-(3-phenylpropyl)acetamide (PubChem CID 50790898) has the molecular formula C24H28N2O4S and a molecular weight of 440.57 g/mol. Its IUPAC name is 2-[4-methyl-1,1,3-trioxo-5-(4-propan-2-ylphenyl)-1,2-thiazol-2-yl]-N-(3-phenylpropyl)acetamide.
| Compound Name | 2-[4-methyl-1,1,3-trioxo-5-(4-propan-2-ylphenyl)-1,2-thiazol-2-yl]-N-(3-phenylpropyl)acetamide |
|---|---|
| PubChem CID | 50790898 |
| Molecular Formula | C24H28N2O4S |
| Molecular Weight | 440.57 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | 2-[4-methyl-1,1,3-trioxo-5-(4-propan-2-ylphenyl)-1,2-thiazol-2-yl]-N-(3-phenylpropyl)acetamide |
| SMILES | CC1=C(c2ccc(C(C)C)cc2)S(=O)(=O)N(CC(=O)NCCCc2ccccc2)C1=O |
| InChI | InChI=1S/C24H28N2O4S/c1-17(2)20-11-13-21(14-12-20)23-18(3)24(28)26(31(23,29)30)16-22(27)25-15-7-10-19-8-5-4-6-9-19/h4-6,8-9,11-14,17H,7,10,15-16H2,1-3H3,(H,25,27) |
| InChIKey | QOQQMLKWZVIUMK-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.57 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|