C27H33N3O5S — CID 50790996
4-(2,4-dimethoxyphenyl)-10-methyl-3-oxo-N-(3-propan-2-yloxypropyl)-5H-[1,4]thiazepino[7,6-b]indole-5-carboxamide (PubChem CID 50790996) has the molecular formula C27H33N3O5S and a molecular weight of 511.64 g/mol. Its IUPAC name is 4-(2,4-dimethoxyphenyl)-10-methyl-3-oxo-N-(3-propan-2-yloxypropyl)-5H-[1,4]thiazepino[7,6-b]indole-5-carboxamide.
| Compound Name | 4-(2,4-dimethoxyphenyl)-10-methyl-3-oxo-N-(3-propan-2-yloxypropyl)-5H-[1,4]thiazepino[7,6-b]indole-5-carboxamide |
|---|---|
| PubChem CID | 50790996 |
| Molecular Formula | C27H33N3O5S |
| Molecular Weight | 511.64 g/mol |
| Exact Mass | 511.21 |
| IUPAC Name | 4-(2,4-dimethoxyphenyl)-10-methyl-3-oxo-N-(3-propan-2-yloxypropyl)-5H-[1,4]thiazepino[7,6-b]indole-5-carboxamide |
| SMILES | COc1ccc(N2C(=O)CSc3c(c4ccccc4n3C)C2C(=O)NCCCOC(C)C)c(OC)c1 |
| InChI | InChI=1S/C27H33N3O5S/c1-17(2)35-14-8-13-28-26(32)25-24-19-9-6-7-10-20(19)29(3)27(24)36-16-23(31)30(25)21-12-11-18(33-4)15-22(21)34-5/h6-7,9-12,15,17,25H,8,13-14,16H2,1-5H3,(H,28,32) |
| InChIKey | VPZAPOCWMBSFAJ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.64 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|