C27H33N3O4S — CID 50791037
4-(4-ethoxyphenyl)-10-methyl-3-oxo-N-(3-propan-2-yloxypropyl)-5H-[1,4]thiazepino[7,6-b]indole-5-carboxamide (PubChem CID 50791037) has the molecular formula C27H33N3O4S and a molecular weight of 495.65 g/mol. Its IUPAC name is 4-(4-ethoxyphenyl)-10-methyl-3-oxo-N-(3-propan-2-yloxypropyl)-5H-[1,4]thiazepino[7,6-b]indole-5-carboxamide.
| Compound Name | 4-(4-ethoxyphenyl)-10-methyl-3-oxo-N-(3-propan-2-yloxypropyl)-5H-[1,4]thiazepino[7,6-b]indole-5-carboxamide |
|---|---|
| PubChem CID | 50791037 |
| Molecular Formula | C27H33N3O4S |
| Molecular Weight | 495.65 g/mol |
| Exact Mass | 495.22 |
| IUPAC Name | 4-(4-ethoxyphenyl)-10-methyl-3-oxo-N-(3-propan-2-yloxypropyl)-5H-[1,4]thiazepino[7,6-b]indole-5-carboxamide |
| SMILES | CCOc1ccc(N2C(=O)CSc3c(c4ccccc4n3C)C2C(=O)NCCCOC(C)C)cc1 |
| InChI | InChI=1S/C27H33N3O4S/c1-5-33-20-13-11-19(12-14-20)30-23(31)17-35-27-24(21-9-6-7-10-22(21)29(27)4)25(30)26(32)28-15-8-16-34-18(2)3/h6-7,9-14,18,25H,5,8,15-17H2,1-4H3,(H,28,32) |
| InChIKey | MLXMUJMYKPCRRO-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.65 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|