C27H31N3O5S — CID 92749012
ethyl 4-[(5R)-5-(3-ethoxypropylcarbamoyl)-10-methyl-3-oxo-5H-[1,4]thiazepino[7,6-b]indol-4-yl]benzoate (PubChem CID 92749012) has the molecular formula C27H31N3O5S and a molecular weight of 509.63 g/mol. Its IUPAC name is ethyl 4-[(5R)-5-(3-ethoxypropylcarbamoyl)-10-methyl-3-oxo-5H-[1,4]thiazepino[7,6-b]indol-4-yl]benzoate.
| Compound Name | ethyl 4-[(5R)-5-(3-ethoxypropylcarbamoyl)-10-methyl-3-oxo-5H-[1,4]thiazepino[7,6-b]indol-4-yl]benzoate |
|---|---|
| PubChem CID | 92749012 |
| Molecular Formula | C27H31N3O5S |
| Molecular Weight | 509.63 g/mol |
| Exact Mass | 509.20 |
| IUPAC Name | ethyl 4-[(5R)-5-(3-ethoxypropylcarbamoyl)-10-methyl-3-oxo-5H-[1,4]thiazepino[7,6-b]indol-4-yl]benzoate |
| SMILES | CCOCCCNC(=O)[C@H]1c2c(n(C)c3ccccc23)SCC(=O)N1c1ccc(C(=O)OCC)cc1 |
| InChI | InChI=1S/C27H31N3O5S/c1-4-34-16-8-15-28-25(32)24-23-20-9-6-7-10-21(20)29(3)26(23)36-17-22(31)30(24)19-13-11-18(12-14-19)27(33)35-5-2/h6-7,9-14,24H,4-5,8,15-17H2,1-3H3,(H,28,32)/t24-/m1/s1 |
| InChIKey | URDLJRBOTZSHBU-XMMPIXPASA-N |
| XLogP | 4.08 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.63 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|