C26H29N3O5S — CID 143130826
4-(1,3-benzodioxol-5-ylmethyl)-N-(3-ethoxypropyl)-10-methyl-3-oxo-5H-[1,4]thiazepino[7,6-b]indole-5-carboxamide (PubChem CID 143130826) has the molecular formula C26H29N3O5S and a molecular weight of 495.60 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-ylmethyl)-N-(3-ethoxypropyl)-10-methyl-3-oxo-5H-[1,4]thiazepino[7,6-b]indole-5-carboxamide.
| Compound Name | 4-(1,3-benzodioxol-5-ylmethyl)-N-(3-ethoxypropyl)-10-methyl-3-oxo-5H-[1,4]thiazepino[7,6-b]indole-5-carboxamide |
|---|---|
| PubChem CID | 143130826 |
| Molecular Formula | C26H29N3O5S |
| Molecular Weight | 495.60 g/mol |
| Exact Mass | 495.18 |
| IUPAC Name | 4-(1,3-benzodioxol-5-ylmethyl)-N-(3-ethoxypropyl)-10-methyl-3-oxo-5H-[1,4]thiazepino[7,6-b]indole-5-carboxamide |
| SMILES | CCOCCCNC(=O)C1c2c(n(C)c3ccccc23)SCC(=O)N1Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C26H29N3O5S/c1-3-32-12-6-11-27-25(31)24-23-18-7-4-5-8-19(18)28(2)26(23)35-15-22(30)29(24)14-17-9-10-20-21(13-17)34-16-33-20/h4-5,7-10,13,24H,3,6,11-12,14-16H2,1-2H3,(H,27,31) |
| InChIKey | LVLCNGUSOPHZQN-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.60 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|