C26H24FN3O5 — CID 50793043
N-[7-(4-ethoxyphenoxy)-1,4-dimethyl-2,3-dioxoquinoxalin-6-yl]-2-(4-fluorophenyl)acetamide (PubChem CID 50793043) has the molecular formula C26H24FN3O5 and a molecular weight of 477.49 g/mol. Its IUPAC name is N-[7-(4-ethoxyphenoxy)-1,4-dimethyl-2,3-dioxoquinoxalin-6-yl]-2-(4-fluorophenyl)acetamide.
| Compound Name | N-[7-(4-ethoxyphenoxy)-1,4-dimethyl-2,3-dioxoquinoxalin-6-yl]-2-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 50793043 |
| Molecular Formula | C26H24FN3O5 |
| Molecular Weight | 477.49 g/mol |
| Exact Mass | 477.17 |
| IUPAC Name | N-[7-(4-ethoxyphenoxy)-1,4-dimethyl-2,3-dioxoquinoxalin-6-yl]-2-(4-fluorophenyl)acetamide |
| SMILES | CCOc1ccc(Oc2cc3c(cc2NC(=O)Cc2ccc(F)cc2)n(C)c(=O)c(=O)n3C)cc1 |
| InChI | InChI=1S/C26H24FN3O5/c1-4-34-18-9-11-19(12-10-18)35-23-15-22-21(29(2)25(32)26(33)30(22)3)14-20(23)28-24(31)13-16-5-7-17(27)8-6-16/h5-12,14-15H,4,13H2,1-3H3,(H,28,31) |
| InChIKey | ZGYXWVWJRWOKQZ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.49 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|