C23H28N4O4 — CID 50792273
N-[7-(diethylamino)-1,4-dimethyl-2,3-dioxoquinoxalin-6-yl]-2-(4-methoxyphenyl)acetamide (PubChem CID 50792273) has the molecular formula C23H28N4O4 and a molecular weight of 424.50 g/mol. Its IUPAC name is N-[7-(diethylamino)-1,4-dimethyl-2,3-dioxoquinoxalin-6-yl]-2-(4-methoxyphenyl)acetamide.
| Compound Name | N-[7-(diethylamino)-1,4-dimethyl-2,3-dioxoquinoxalin-6-yl]-2-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 50792273 |
| Molecular Formula | C23H28N4O4 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | N-[7-(diethylamino)-1,4-dimethyl-2,3-dioxoquinoxalin-6-yl]-2-(4-methoxyphenyl)acetamide |
| SMILES | CCN(CC)c1cc2c(cc1NC(=O)Cc1ccc(OC)cc1)n(C)c(=O)c(=O)n2C |
| InChI | InChI=1S/C23H28N4O4/c1-6-27(7-2)18-14-20-19(25(3)22(29)23(30)26(20)4)13-17(18)24-21(28)12-15-8-10-16(31-5)11-9-15/h8-11,13-14H,6-7,12H2,1-5H3,(H,24,28) |
| InChIKey | WGVPJPMFMIRRMH-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 85.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|