C17H21N3O3S — CID 50795469
5-[benzenesulfonyl(methyl)amino]-N-butan-2-ylpyridine-3-carboxamide (PubChem CID 50795469) has the molecular formula C17H21N3O3S and a molecular weight of 347.44 g/mol. Its IUPAC name is 5-[benzenesulfonyl(methyl)amino]-N-butan-2-ylpyridine-3-carboxamide.
| Compound Name | 5-[benzenesulfonyl(methyl)amino]-N-butan-2-ylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 50795469 |
| Molecular Formula | C17H21N3O3S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | 5-[benzenesulfonyl(methyl)amino]-N-butan-2-ylpyridine-3-carboxamide |
| SMILES | CCC(C)NC(=O)c1cncc(N(C)S(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C17H21N3O3S/c1-4-13(2)19-17(21)14-10-15(12-18-11-14)20(3)24(22,23)16-8-6-5-7-9-16/h5-13H,4H2,1-3H3,(H,19,21) |
| InChIKey | VDUGBQXEQAJHRJ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |