C25H32N4O4S — CID 50801779
N,N-diethyl-2-[4-(4-methoxyphenyl)piperazine-1-carbonyl]-1-methylindole-5-sulfonamide (PubChem CID 50801779) has the molecular formula C25H32N4O4S and a molecular weight of 484.62 g/mol. Its IUPAC name is N,N-diethyl-2-[4-(4-methoxyphenyl)piperazine-1-carbonyl]-1-methylindole-5-sulfonamide.
| Compound Name | N,N-diethyl-2-[4-(4-methoxyphenyl)piperazine-1-carbonyl]-1-methylindole-5-sulfonamide |
|---|---|
| PubChem CID | 50801779 |
| Molecular Formula | C25H32N4O4S |
| Molecular Weight | 484.62 g/mol |
| Exact Mass | 484.21 |
| IUPAC Name | N,N-diethyl-2-[4-(4-methoxyphenyl)piperazine-1-carbonyl]-1-methylindole-5-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc2c(c1)cc(C(=O)N1CCN(c3ccc(OC)cc3)CC1)n2C |
| InChI | InChI=1S/C25H32N4O4S/c1-5-29(6-2)34(31,32)22-11-12-23-19(17-22)18-24(26(23)3)25(30)28-15-13-27(14-16-28)20-7-9-21(33-4)10-8-20/h7-12,17-18H,5-6,13-16H2,1-4H3 |
| InChIKey | HSGVQXJZKWDECK-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 75.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.62 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|