C23H32N4O4S — CID 53068718
[4-[4-(4-methoxyphenyl)piperazin-1-yl]sulfonyl-1,5-dimethylpyrrol-2-yl]-piperidin-1-ylmethanone (PubChem CID 53068718) has the molecular formula C23H32N4O4S and a molecular weight of 460.60 g/mol. Its IUPAC name is [4-[4-(4-methoxyphenyl)piperazin-1-yl]sulfonyl-1,5-dimethylpyrrol-2-yl]-piperidin-1-ylmethanone.
| Compound Name | [4-[4-(4-methoxyphenyl)piperazin-1-yl]sulfonyl-1,5-dimethylpyrrol-2-yl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 53068718 |
| Molecular Formula | C23H32N4O4S |
| Molecular Weight | 460.60 g/mol |
| Exact Mass | 460.21 |
| IUPAC Name | [4-[4-(4-methoxyphenyl)piperazin-1-yl]sulfonyl-1,5-dimethylpyrrol-2-yl]-piperidin-1-ylmethanone |
| SMILES | COc1ccc(N2CCN(S(=O)(=O)c3cc(C(=O)N4CCCCC4)n(C)c3C)CC2)cc1 |
| InChI | InChI=1S/C23H32N4O4S/c1-18-22(17-21(24(18)2)23(28)26-11-5-4-6-12-26)32(29,30)27-15-13-25(14-16-27)19-7-9-20(31-3)10-8-19/h7-10,17H,4-6,11-16H2,1-3H3 |
| InChIKey | PAYOVLLZBLVTEQ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 75.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.60 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|