C28H37NO7 — CID 5080615
3-[2-[6-(10-hydroxydecylidene)-3-oxopyran-2-yl]-2-methoxyacetyl]-4-methyl-5-phenyl-1,3-oxazolidin-2-one (PubChem CID 5080615) has the molecular formula C28H37NO7 and a molecular weight of 499.60 g/mol. Its IUPAC name is 3-[2-[6-(10-hydroxydecylidene)-3-oxopyran-2-yl]-2-methoxyacetyl]-4-methyl-5-phenyl-1,3-oxazolidin-2-one.
| Compound Name | 3-[2-[6-(10-hydroxydecylidene)-3-oxopyran-2-yl]-2-methoxyacetyl]-4-methyl-5-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 5080615 |
| Molecular Formula | C28H37NO7 |
| Molecular Weight | 499.60 g/mol |
| Exact Mass | 499.26 |
| IUPAC Name | 3-[2-[6-(10-hydroxydecylidene)-3-oxopyran-2-yl]-2-methoxyacetyl]-4-methyl-5-phenyl-1,3-oxazolidin-2-one |
| SMILES | COC(C(=O)N1C(=O)OC(c2ccccc2)C1C)C1OC(=CCCCCCCCCCO)C=CC1=O |
| InChI | InChI=1S/C28H37NO7/c1-20-24(21-14-10-9-11-15-21)36-28(33)29(20)27(32)26(34-2)25-23(31)18-17-22(35-25)16-12-7-5-3-4-6-8-13-19-30/h9-11,14-18,20,24-26,30H,3-8,12-13,19H2,1-2H3 |
| InChIKey | RWFHSFCYUUZPMJ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.60 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|