C30H33NO6 — CID 5243031
4-benzyl-3-[2-[6-(6-hydroxyhexylidene)-3-oxopyran-2-yl]-3-phenylpropanoyl]-1,3-oxazolidin-2-one (PubChem CID 5243031) has the molecular formula C30H33NO6 and a molecular weight of 503.60 g/mol. Its IUPAC name is 4-benzyl-3-[2-[6-(6-hydroxyhexylidene)-3-oxopyran-2-yl]-3-phenylpropanoyl]-1,3-oxazolidin-2-one.
| Compound Name | 4-benzyl-3-[2-[6-(6-hydroxyhexylidene)-3-oxopyran-2-yl]-3-phenylpropanoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 5243031 |
| Molecular Formula | C30H33NO6 |
| Molecular Weight | 503.60 g/mol |
| Exact Mass | 503.23 |
| IUPAC Name | 4-benzyl-3-[2-[6-(6-hydroxyhexylidene)-3-oxopyran-2-yl]-3-phenylpropanoyl]-1,3-oxazolidin-2-one |
| SMILES | O=C1C=CC(=CCCCCCO)OC1C(Cc1ccccc1)C(=O)N1C(=O)OCC1Cc1ccccc1 |
| InChI | InChI=1S/C30H33NO6/c32-18-10-2-1-9-15-25-16-17-27(33)28(37-25)26(20-23-13-7-4-8-14-23)29(34)31-24(21-36-30(31)35)19-22-11-5-3-6-12-22/h3-8,11-17,24,26,28,32H,1-2,9-10,18-21H2 |
| InChIKey | RNHGGYCBAYSFTG-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.60 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|