C26H22N4O3S — CID 50807196
N-(4-ethoxyphenyl)-2-(11-methyl-6-oxo-13-phenyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-5-yl)acetamide (PubChem CID 50807196) has the molecular formula C26H22N4O3S and a molecular weight of 470.55 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-2-(11-methyl-6-oxo-13-phenyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-5-yl)acetamide.
| Compound Name | N-(4-ethoxyphenyl)-2-(11-methyl-6-oxo-13-phenyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-5-yl)acetamide |
|---|---|
| PubChem CID | 50807196 |
| Molecular Formula | C26H22N4O3S |
| Molecular Weight | 470.55 g/mol |
| Exact Mass | 470.14 |
| IUPAC Name | N-(4-ethoxyphenyl)-2-(11-methyl-6-oxo-13-phenyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-5-yl)acetamide |
| SMILES | CCOc1ccc(NC(=O)Cn2cnc3c(sc4nc(C)cc(-c5ccccc5)c43)c2=O)cc1 |
| InChI | InChI=1S/C26H22N4O3S/c1-3-33-19-11-9-18(10-12-19)29-21(31)14-30-15-27-23-22-20(17-7-5-4-6-8-17)13-16(2)28-25(22)34-24(23)26(30)32/h4-13,15H,3,14H2,1-2H3,(H,29,31) |
| InChIKey | ZUFNRGWBWYBZKG-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.55 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |