C24H18N4O2S — CID 50807179
2-(11-methyl-6-oxo-13-phenyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-5-yl)-N-phenylacetamide (PubChem CID 50807179) has the molecular formula C24H18N4O2S and a molecular weight of 426.50 g/mol. Its IUPAC name is 2-(11-methyl-6-oxo-13-phenyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-5-yl)-N-phenylacetamide.
| Compound Name | 2-(11-methyl-6-oxo-13-phenyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-5-yl)-N-phenylacetamide |
|---|---|
| PubChem CID | 50807179 |
| Molecular Formula | C24H18N4O2S |
| Molecular Weight | 426.50 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | 2-(11-methyl-6-oxo-13-phenyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-5-yl)-N-phenylacetamide |
| SMILES | Cc1cc(-c2ccccc2)c2c(n1)sc1c(=O)n(CC(=O)Nc3ccccc3)cnc12 |
| InChI | InChI=1S/C24H18N4O2S/c1-15-12-18(16-8-4-2-5-9-16)20-21-22(31-23(20)26-15)24(30)28(14-25-21)13-19(29)27-17-10-6-3-7-11-17/h2-12,14H,13H2,1H3,(H,27,29) |
| InChIKey | YCALLEKDWDJLCP-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.50 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |