C26H21FN4O3 — CID 50812935
N-[2-[2-(3-fluoroanilino)-2-oxoethyl]-6-(4-methylphenyl)-3-oxopyridazin-4-yl]benzamide (PubChem CID 50812935) has the molecular formula C26H21FN4O3 and a molecular weight of 456.48 g/mol. Its IUPAC name is N-[2-[2-(3-fluoroanilino)-2-oxoethyl]-6-(4-methylphenyl)-3-oxopyridazin-4-yl]benzamide.
| Compound Name | N-[2-[2-(3-fluoroanilino)-2-oxoethyl]-6-(4-methylphenyl)-3-oxopyridazin-4-yl]benzamide |
|---|---|
| PubChem CID | 50812935 |
| Molecular Formula | C26H21FN4O3 |
| Molecular Weight | 456.48 g/mol |
| Exact Mass | 456.16 |
| IUPAC Name | N-[2-[2-(3-fluoroanilino)-2-oxoethyl]-6-(4-methylphenyl)-3-oxopyridazin-4-yl]benzamide |
| SMILES | Cc1ccc(-c2cc(NC(=O)c3ccccc3)c(=O)n(CC(=O)Nc3cccc(F)c3)n2)cc1 |
| InChI | InChI=1S/C26H21FN4O3/c1-17-10-12-18(13-11-17)22-15-23(29-25(33)19-6-3-2-4-7-19)26(34)31(30-22)16-24(32)28-21-9-5-8-20(27)14-21/h2-15H,16H2,1H3,(H,28,32)(H,29,33) |
| InChIKey | UIIRAINWOQWKGH-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.48 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |