C21H33ClN4O3S — CID 50820945
4-chloro-N-(2-piperazin-1-ylsulfonylethyl)-N-(3-piperidin-1-ylpropyl)benzamide (PubChem CID 50820945) has the molecular formula C21H33ClN4O3S and a molecular weight of 457.04 g/mol. Its IUPAC name is 4-chloro-N-(2-piperazin-1-ylsulfonylethyl)-N-(3-piperidin-1-ylpropyl)benzamide.
| Compound Name | 4-chloro-N-(2-piperazin-1-ylsulfonylethyl)-N-(3-piperidin-1-ylpropyl)benzamide |
|---|---|
| PubChem CID | 50820945 |
| Molecular Formula | C21H33ClN4O3S |
| Molecular Weight | 457.04 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | 4-chloro-N-(2-piperazin-1-ylsulfonylethyl)-N-(3-piperidin-1-ylpropyl)benzamide |
| SMILES | O=C(c1ccc(Cl)cc1)N(CCCN1CCCCC1)CCS(=O)(=O)N1CCNCC1 |
| InChI | InChI=1S/C21H33ClN4O3S/c22-20-7-5-19(6-8-20)21(27)25(14-4-13-24-11-2-1-3-12-24)17-18-30(28,29)26-15-9-23-10-16-26/h5-8,23H,1-4,9-18H2 |
| InChIKey | VANPCLXDZXDZNO-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.04 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |