C15H25N3O3S2 — CID 50821050
N-(2-methylpropyl)-N-(2-piperazin-1-ylsulfonylethyl)thiophene-2-carboxamide (PubChem CID 50821050) has the molecular formula C15H25N3O3S2 and a molecular weight of 359.52 g/mol. Its IUPAC name is N-(2-methylpropyl)-N-(2-piperazin-1-ylsulfonylethyl)thiophene-2-carboxamide.
| Compound Name | N-(2-methylpropyl)-N-(2-piperazin-1-ylsulfonylethyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 50821050 |
| Molecular Formula | C15H25N3O3S2 |
| Molecular Weight | 359.52 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | N-(2-methylpropyl)-N-(2-piperazin-1-ylsulfonylethyl)thiophene-2-carboxamide |
| SMILES | CC(C)CN(CCS(=O)(=O)N1CCNCC1)C(=O)c1cccs1 |
| InChI | InChI=1S/C15H25N3O3S2/c1-13(2)12-17(15(19)14-4-3-10-22-14)9-11-23(20,21)18-7-5-16-6-8-18/h3-4,10,13,16H,5-9,11-12H2,1-2H3 |
| InChIKey | VIVHLELTLSXSJK-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.52 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |