C21H27N3O3S2 — CID 50822754
1-[2-[1-(benzenesulfonyl)piperidin-4-yl]ethyl]-3-(3-methylsulfanylphenyl)urea (PubChem CID 50822754) has the molecular formula C21H27N3O3S2 and a molecular weight of 433.60 g/mol. Its IUPAC name is 1-[2-[1-(benzenesulfonyl)piperidin-4-yl]ethyl]-3-(3-methylsulfanylphenyl)urea.
| Compound Name | 1-[2-[1-(benzenesulfonyl)piperidin-4-yl]ethyl]-3-(3-methylsulfanylphenyl)urea |
|---|---|
| PubChem CID | 50822754 |
| Molecular Formula | C21H27N3O3S2 |
| Molecular Weight | 433.60 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | 1-[2-[1-(benzenesulfonyl)piperidin-4-yl]ethyl]-3-(3-methylsulfanylphenyl)urea |
| SMILES | CSc1cccc(NC(=O)NCCC2CCN(S(=O)(=O)c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C21H27N3O3S2/c1-28-19-7-5-6-18(16-19)23-21(25)22-13-10-17-11-14-24(15-12-17)29(26,27)20-8-3-2-4-9-20/h2-9,16-17H,10-15H2,1H3,(H2,22,23,25) |
| InChIKey | RRISOJXUZPQEJF-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.60 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |