C21H30N6O3 — CID 50827958
N-[3-(4-methylpiperazin-1-yl)propyl]-3-(4-morpholin-4-ylphenyl)-1,2,4-oxadiazole-5-carboxamide (PubChem CID 50827958) has the molecular formula C21H30N6O3 and a molecular weight of 414.51 g/mol. Its IUPAC name is N-[3-(4-methylpiperazin-1-yl)propyl]-3-(4-morpholin-4-ylphenyl)-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | N-[3-(4-methylpiperazin-1-yl)propyl]-3-(4-morpholin-4-ylphenyl)-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 50827958 |
| Molecular Formula | C21H30N6O3 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.24 |
| IUPAC Name | N-[3-(4-methylpiperazin-1-yl)propyl]-3-(4-morpholin-4-ylphenyl)-1,2,4-oxadiazole-5-carboxamide |
| SMILES | CN1CCN(CCCNC(=O)c2nc(-c3ccc(N4CCOCC4)cc3)no2)CC1 |
| InChI | InChI=1S/C21H30N6O3/c1-25-9-11-26(12-10-25)8-2-7-22-20(28)21-23-19(24-30-21)17-3-5-18(6-4-17)27-13-15-29-16-14-27/h3-6H,2,7-16H2,1H3,(H,22,28) |
| InChIKey | XFOXVDPZYDJZQR-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 86.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|