C21H27N5O3 — CID 53104918
3-(3,7-dimethyl-1-benzofuran-2-yl)-N-[3-(4-methylpiperazin-1-yl)propyl]-1,2,4-oxadiazole-5-carboxamide (PubChem CID 53104918) has the molecular formula C21H27N5O3 and a molecular weight of 397.48 g/mol. Its IUPAC name is 3-(3,7-dimethyl-1-benzofuran-2-yl)-N-[3-(4-methylpiperazin-1-yl)propyl]-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | 3-(3,7-dimethyl-1-benzofuran-2-yl)-N-[3-(4-methylpiperazin-1-yl)propyl]-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 53104918 |
| Molecular Formula | C21H27N5O3 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.21 |
| IUPAC Name | 3-(3,7-dimethyl-1-benzofuran-2-yl)-N-[3-(4-methylpiperazin-1-yl)propyl]-1,2,4-oxadiazole-5-carboxamide |
| SMILES | Cc1c(-c2noc(C(=O)NCCCN3CCN(C)CC3)n2)oc2c(C)cccc12 |
| InChI | InChI=1S/C21H27N5O3/c1-14-6-4-7-16-15(2)18(28-17(14)16)19-23-21(29-24-19)20(27)22-8-5-9-26-12-10-25(3)11-13-26/h4,6-7H,5,8-13H2,1-3H3,(H,22,27) |
| InChIKey | JMNPUJHSKBTXHT-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 87.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|