C21H25N7O2 — CID 50847223
N-[3-(4-benzylpiperazin-1-yl)propyl]-3-pyrimidin-4-yl-1,2,4-oxadiazole-5-carboxamide (PubChem CID 50847223) has the molecular formula C21H25N7O2 and a molecular weight of 407.48 g/mol. Its IUPAC name is N-[3-(4-benzylpiperazin-1-yl)propyl]-3-pyrimidin-4-yl-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | N-[3-(4-benzylpiperazin-1-yl)propyl]-3-pyrimidin-4-yl-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 50847223 |
| Molecular Formula | C21H25N7O2 |
| Molecular Weight | 407.48 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | N-[3-(4-benzylpiperazin-1-yl)propyl]-3-pyrimidin-4-yl-1,2,4-oxadiazole-5-carboxamide |
| SMILES | O=C(NCCCN1CCN(Cc2ccccc2)CC1)c1nc(-c2ccncn2)no1 |
| InChI | InChI=1S/C21H25N7O2/c29-20(21-25-19(26-30-21)18-7-9-22-16-24-18)23-8-4-10-27-11-13-28(14-12-27)15-17-5-2-1-3-6-17/h1-3,5-7,9,16H,4,8,10-15H2,(H,23,29) |
| InChIKey | CNIJOGPZFGOLKS-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 100.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.48 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|