C15H18F11NO — CID 5082888
N,N-dibutyl-1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexane-1-carboxamide (PubChem CID 5082888) has the molecular formula C15H18F11NO and a molecular weight of 437.29 g/mol. Its IUPAC name is N,N-dibutyl-1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexane-1-carboxamide.
| Compound Name | N,N-dibutyl-1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 5082888 |
| Molecular Formula | C15H18F11NO |
| Molecular Weight | 437.29 g/mol |
| Exact Mass | 437.12 |
| IUPAC Name | N,N-dibutyl-1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexane-1-carboxamide |
| SMILES | CCCCN(CCCC)C(=O)C1(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C15H18F11NO/c1-3-5-7-27(8-6-4-2)9(28)10(16)11(17,18)13(21,22)15(25,26)14(23,24)12(10,19)20/h3-8H2,1-2H3 |
| InChIKey | XTVUIZONQTXZLH-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.29 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|