C40H55NO6 — CID 5082895
ethyl N-[(6,6-dimethyl-2-bicyclo[3.1.1]heptanyl)methyl]-N-[[17-(furan-2-carbonyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]carbamate (PubChem CID 5082895) has the molecular formula C40H55NO6 and a molecular weight of 645.88 g/mol. Its IUPAC name is ethyl N-[(6,6-dimethyl-2-bicyclo[3.1.1]heptanyl)methyl]-N-[[17-(furan-2-carbonyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]carbamate.
| Compound Name | ethyl N-[(6,6-dimethyl-2-bicyclo[3.1.1]heptanyl)methyl]-N-[[17-(furan-2-carbonyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]carbamate |
|---|---|
| PubChem CID | 5082895 |
| Molecular Formula | C40H55NO6 |
| Molecular Weight | 645.88 g/mol |
| Exact Mass | 645.40 |
| IUPAC Name | ethyl N-[(6,6-dimethyl-2-bicyclo[3.1.1]heptanyl)methyl]-N-[[17-(furan-2-carbonyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]carbamate |
| SMILES | CCOC(=O)N(CC1CCC2CC1C2(C)C)CC1(O)CCC2C34C=CC5(C=C3C(=O)c3ccco3)CC(O)CCC5(C)C4CCC21C |
| InChI | InChI=1S/C40H55NO6/c1-6-46-34(44)41(23-25-9-10-26-20-28(25)35(26,2)3)24-39(45)16-13-32-37(39,5)15-12-31-36(4)14-11-27(42)21-38(36)17-18-40(31,32)29(22-38)33(43)30-8-7-19-47-30/h7-8,17-19,22,25-28,31-32,42,45H,6,9-16,20-21,23-24H2,1-5H3 |
| InChIKey | HVYLQJQJWDBHGN-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.88 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|