C16H15N5O — CID 5082935
2-(benzimidazol-1-yl)-N'-(1-pyridin-3-ylethenyl)acetohydrazide (PubChem CID 5082935) has the molecular formula C16H15N5O and a molecular weight of 293.33 g/mol. Its IUPAC name is 2-(benzimidazol-1-yl)-N'-(1-pyridin-3-ylethenyl)acetohydrazide.
| Compound Name | 2-(benzimidazol-1-yl)-N'-(1-pyridin-3-ylethenyl)acetohydrazide |
|---|---|
| PubChem CID | 5082935 |
| Molecular Formula | C16H15N5O |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | 2-(benzimidazol-1-yl)-N'-(1-pyridin-3-ylethenyl)acetohydrazide |
| SMILES | C=C(NNC(=O)Cn1cnc2ccccc21)c1cccnc1 |
| InChI | InChI=1S/C16H15N5O/c1-12(13-5-4-8-17-9-13)19-20-16(22)10-21-11-18-14-6-2-3-7-15(14)21/h2-9,11,19H,1,10H2,(H,20,22) |
| InChIKey | LWZXDUPXZRTQCJ-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|