C21H19F2N3O3 — CID 50830342
N-(8-fluoro-2-morpholin-4-ylquinolin-6-yl)-2-(4-fluorophenoxy)acetamide (PubChem CID 50830342) has the molecular formula C21H19F2N3O3 and a molecular weight of 399.40 g/mol. Its IUPAC name is N-(8-fluoro-2-morpholin-4-ylquinolin-6-yl)-2-(4-fluorophenoxy)acetamide.
| Compound Name | N-(8-fluoro-2-morpholin-4-ylquinolin-6-yl)-2-(4-fluorophenoxy)acetamide |
|---|---|
| PubChem CID | 50830342 |
| Molecular Formula | C21H19F2N3O3 |
| Molecular Weight | 399.40 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | N-(8-fluoro-2-morpholin-4-ylquinolin-6-yl)-2-(4-fluorophenoxy)acetamide |
| SMILES | O=C(COc1ccc(F)cc1)Nc1cc(F)c2nc(N3CCOCC3)ccc2c1 |
| InChI | InChI=1S/C21H19F2N3O3/c22-15-2-4-17(5-3-15)29-13-20(27)24-16-11-14-1-6-19(25-21(14)18(23)12-16)26-7-9-28-10-8-26/h1-6,11-12H,7-10,13H2,(H,24,27) |
| InChIKey | LGQOGCUKQYJNDV-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.40 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |