C18H25FN4O3 — CID 50831401
N-(4-fluorophenyl)-4-[2-(3-methylbutylamino)-2-oxoethyl]-3-oxopiperazine-1-carboxamide (PubChem CID 50831401) has the molecular formula C18H25FN4O3 and a molecular weight of 364.42 g/mol. Its IUPAC name is N-(4-fluorophenyl)-4-[2-(3-methylbutylamino)-2-oxoethyl]-3-oxopiperazine-1-carboxamide.
| Compound Name | N-(4-fluorophenyl)-4-[2-(3-methylbutylamino)-2-oxoethyl]-3-oxopiperazine-1-carboxamide |
|---|---|
| PubChem CID | 50831401 |
| Molecular Formula | C18H25FN4O3 |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | N-(4-fluorophenyl)-4-[2-(3-methylbutylamino)-2-oxoethyl]-3-oxopiperazine-1-carboxamide |
| SMILES | CC(C)CCNC(=O)CN1CCN(C(=O)Nc2ccc(F)cc2)CC1=O |
| InChI | InChI=1S/C18H25FN4O3/c1-13(2)7-8-20-16(24)11-22-9-10-23(12-17(22)25)18(26)21-15-5-3-14(19)4-6-15/h3-6,13H,7-12H2,1-2H3,(H,20,24)(H,21,26) |
| InChIKey | XDYFHFJCGWTMFL-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |