C22H32ClN5O3 — CID 50831187
4-[2-[3-(azepan-1-yl)propylamino]-2-oxoethyl]-N-(4-chlorophenyl)-3-oxopiperazine-1-carboxamide (PubChem CID 50831187) has the molecular formula C22H32ClN5O3 and a molecular weight of 449.98 g/mol. Its IUPAC name is 4-[2-[3-(azepan-1-yl)propylamino]-2-oxoethyl]-N-(4-chlorophenyl)-3-oxopiperazine-1-carboxamide.
| Compound Name | 4-[2-[3-(azepan-1-yl)propylamino]-2-oxoethyl]-N-(4-chlorophenyl)-3-oxopiperazine-1-carboxamide |
|---|---|
| PubChem CID | 50831187 |
| Molecular Formula | C22H32ClN5O3 |
| Molecular Weight | 449.98 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | 4-[2-[3-(azepan-1-yl)propylamino]-2-oxoethyl]-N-(4-chlorophenyl)-3-oxopiperazine-1-carboxamide |
| SMILES | O=C(CN1CCN(C(=O)Nc2ccc(Cl)cc2)CC1=O)NCCCN1CCCCCC1 |
| InChI | InChI=1S/C22H32ClN5O3/c23-18-6-8-19(9-7-18)25-22(31)28-15-14-27(21(30)17-28)16-20(29)24-10-5-13-26-11-3-1-2-4-12-26/h6-9H,1-5,10-17H2,(H,24,29)(H,25,31) |
| InChIKey | RELQGCVXXHPPKU-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.98 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|