C23H24N4O2 — CID 50832290
4-(6-oxo-3-pyrrolidin-1-ylpyridazin-1-yl)-N-(2-phenylethyl)benzamide (PubChem CID 50832290) has the molecular formula C23H24N4O2 and a molecular weight of 388.47 g/mol. Its IUPAC name is 4-(6-oxo-3-pyrrolidin-1-ylpyridazin-1-yl)-N-(2-phenylethyl)benzamide.
| Compound Name | 4-(6-oxo-3-pyrrolidin-1-ylpyridazin-1-yl)-N-(2-phenylethyl)benzamide |
|---|---|
| PubChem CID | 50832290 |
| Molecular Formula | C23H24N4O2 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | 4-(6-oxo-3-pyrrolidin-1-ylpyridazin-1-yl)-N-(2-phenylethyl)benzamide |
| SMILES | O=C(NCCc1ccccc1)c1ccc(-n2nc(N3CCCC3)ccc2=O)cc1 |
| InChI | InChI=1S/C23H24N4O2/c28-22-13-12-21(26-16-4-5-17-26)25-27(22)20-10-8-19(9-11-20)23(29)24-15-14-18-6-2-1-3-7-18/h1-3,6-13H,4-5,14-17H2,(H,24,29) |
| InChIKey | RCBZFEUEZNUCTA-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |