C22H21ClN4O2S — CID 50834030
N-[2-(4-chlorophenyl)ethyl]-2-(4,11,13-trimethyl-6-oxo-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-5-yl)acetamide (PubChem CID 50834030) has the molecular formula C22H21ClN4O2S and a molecular weight of 440.96 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)ethyl]-2-(4,11,13-trimethyl-6-oxo-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-5-yl)acetamide.
| Compound Name | N-[2-(4-chlorophenyl)ethyl]-2-(4,11,13-trimethyl-6-oxo-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-5-yl)acetamide |
|---|---|
| PubChem CID | 50834030 |
| Molecular Formula | C22H21ClN4O2S |
| Molecular Weight | 440.96 g/mol |
| Exact Mass | 440.11 |
| IUPAC Name | N-[2-(4-chlorophenyl)ethyl]-2-(4,11,13-trimethyl-6-oxo-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-5-yl)acetamide |
| SMILES | Cc1cc(C)c2c(n1)sc1c(=O)n(CC(=O)NCCc3ccc(Cl)cc3)c(C)nc12 |
| InChI | InChI=1S/C22H21ClN4O2S/c1-12-10-13(2)25-21-18(12)19-20(30-21)22(29)27(14(3)26-19)11-17(28)24-9-8-15-4-6-16(23)7-5-15/h4-7,10H,8-9,11H2,1-3H3,(H,24,28) |
| InChIKey | RZTDAWZDDZJOGE-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.96 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |