C21H28N4O3S — CID 50834568
N-butyl-2-(8-methoxy-5-methyl-4-oxo-3-propylpyrimido[5,4-b]indol-2-yl)sulfanylacetamide (PubChem CID 50834568) has the molecular formula C21H28N4O3S and a molecular weight of 416.55 g/mol. Its IUPAC name is N-butyl-2-(8-methoxy-5-methyl-4-oxo-3-propylpyrimido[5,4-b]indol-2-yl)sulfanylacetamide.
| Compound Name | N-butyl-2-(8-methoxy-5-methyl-4-oxo-3-propylpyrimido[5,4-b]indol-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 50834568 |
| Molecular Formula | C21H28N4O3S |
| Molecular Weight | 416.55 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | N-butyl-2-(8-methoxy-5-methyl-4-oxo-3-propylpyrimido[5,4-b]indol-2-yl)sulfanylacetamide |
| SMILES | CCCCNC(=O)CSc1nc2c3cc(OC)ccc3n(C)c2c(=O)n1CCC |
| InChI | InChI=1S/C21H28N4O3S/c1-5-7-10-22-17(26)13-29-21-23-18-15-12-14(28-4)8-9-16(15)24(3)19(18)20(27)25(21)11-6-2/h8-9,12H,5-7,10-11,13H2,1-4H3,(H,22,26) |
| InChIKey | HYQGODPREGVOHI-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 78.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.55 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|