C24H24F2N6O4 — CID 50836907
N-butan-2-yl-3-[2-[2-(2,5-difluoroanilino)-2-oxoethyl]-1,5-dioxo-[1,2,4]triazolo[4,3-a]quinazolin-4-yl]propanamide (PubChem CID 50836907) has the molecular formula C24H24F2N6O4 and a molecular weight of 498.49 g/mol. Its IUPAC name is N-butan-2-yl-3-[2-[2-(2,5-difluoroanilino)-2-oxoethyl]-1,5-dioxo-[1,2,4]triazolo[4,3-a]quinazolin-4-yl]propanamide.
| Compound Name | N-butan-2-yl-3-[2-[2-(2,5-difluoroanilino)-2-oxoethyl]-1,5-dioxo-[1,2,4]triazolo[4,3-a]quinazolin-4-yl]propanamide |
|---|---|
| PubChem CID | 50836907 |
| Molecular Formula | C24H24F2N6O4 |
| Molecular Weight | 498.49 g/mol |
| Exact Mass | 498.18 |
| IUPAC Name | N-butan-2-yl-3-[2-[2-(2,5-difluoroanilino)-2-oxoethyl]-1,5-dioxo-[1,2,4]triazolo[4,3-a]quinazolin-4-yl]propanamide |
| SMILES | CCC(C)NC(=O)CCn1c(=O)c2ccccc2n2c(=O)n(CC(=O)Nc3cc(F)ccc3F)nc12 |
| InChI | InChI=1S/C24H24F2N6O4/c1-3-14(2)27-20(33)10-11-30-22(35)16-6-4-5-7-19(16)32-23(30)29-31(24(32)36)13-21(34)28-18-12-15(25)8-9-17(18)26/h4-9,12,14H,3,10-11,13H2,1-2H3,(H,27,33)(H,28,34) |
| InChIKey | HRDCCYSUDZTCMJ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 119.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.49 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |