C20H19F2N3O3 — CID 51046736
2-(3-butan-2-yl-2,4-dioxoquinazolin-1-yl)-N-(2,5-difluorophenyl)acetamide (PubChem CID 51046736) has the molecular formula C20H19F2N3O3 and a molecular weight of 387.39 g/mol. Its IUPAC name is 2-(3-butan-2-yl-2,4-dioxoquinazolin-1-yl)-N-(2,5-difluorophenyl)acetamide.
| Compound Name | 2-(3-butan-2-yl-2,4-dioxoquinazolin-1-yl)-N-(2,5-difluorophenyl)acetamide |
|---|---|
| PubChem CID | 51046736 |
| Molecular Formula | C20H19F2N3O3 |
| Molecular Weight | 387.39 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | 2-(3-butan-2-yl-2,4-dioxoquinazolin-1-yl)-N-(2,5-difluorophenyl)acetamide |
| SMILES | CCC(C)n1c(=O)c2ccccc2n(CC(=O)Nc2cc(F)ccc2F)c1=O |
| InChI | InChI=1S/C20H19F2N3O3/c1-3-12(2)25-19(27)14-6-4-5-7-17(14)24(20(25)28)11-18(26)23-16-10-13(21)8-9-15(16)22/h4-10,12H,3,11H2,1-2H3,(H,23,26) |
| InChIKey | JADMGYXXQRDPLI-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 73.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.39 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |