C17H23N3O3 — CID 51046763
2-(3-butan-2-yl-2,4-dioxoquinazolin-1-yl)-N-propylacetamide (PubChem CID 51046763) has the molecular formula C17H23N3O3 and a molecular weight of 317.39 g/mol. Its IUPAC name is 2-(3-butan-2-yl-2,4-dioxoquinazolin-1-yl)-N-propylacetamide.
| Compound Name | 2-(3-butan-2-yl-2,4-dioxoquinazolin-1-yl)-N-propylacetamide |
|---|---|
| PubChem CID | 51046763 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | 2-(3-butan-2-yl-2,4-dioxoquinazolin-1-yl)-N-propylacetamide |
| SMILES | CCCNC(=O)Cn1c(=O)n(C(C)CC)c(=O)c2ccccc21 |
| InChI | InChI=1S/C17H23N3O3/c1-4-10-18-15(21)11-19-14-9-7-6-8-13(14)16(22)20(17(19)23)12(3)5-2/h6-9,12H,4-5,10-11H2,1-3H3,(H,18,21) |
| InChIKey | NWBXNUCOLZYGDG-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 73.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |