C21H18N4O3S2 — CID 50837971
N-(2,1,3-benzothiadiazol-4-yl)-3-[(4-ethylphenyl)sulfonylamino]benzamide (PubChem CID 50837971) has the molecular formula C21H18N4O3S2 and a molecular weight of 438.53 g/mol. Its IUPAC name is N-(2,1,3-benzothiadiazol-4-yl)-3-[(4-ethylphenyl)sulfonylamino]benzamide.
| Compound Name | N-(2,1,3-benzothiadiazol-4-yl)-3-[(4-ethylphenyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 50837971 |
| Molecular Formula | C21H18N4O3S2 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.08 |
| IUPAC Name | N-(2,1,3-benzothiadiazol-4-yl)-3-[(4-ethylphenyl)sulfonylamino]benzamide |
| SMILES | CCc1ccc(S(=O)(=O)Nc2cccc(C(=O)Nc3cccc4nsnc34)c2)cc1 |
| InChI | InChI=1S/C21H18N4O3S2/c1-2-14-9-11-17(12-10-14)30(27,28)25-16-6-3-5-15(13-16)21(26)22-18-7-4-8-19-20(18)24-29-23-19/h3-13,25H,2H2,1H3,(H,22,26) |
| InChIKey | PUDSYRLOXUQEGG-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |