C19H13BrN4O3S2 — CID 46393977
N-(2,1,3-benzothiadiazol-4-yl)-3-[(2-bromophenyl)sulfonylamino]benzamide (PubChem CID 46393977) has the molecular formula C19H13BrN4O3S2 and a molecular weight of 489.38 g/mol. Its IUPAC name is N-(2,1,3-benzothiadiazol-4-yl)-3-[(2-bromophenyl)sulfonylamino]benzamide.
| Compound Name | N-(2,1,3-benzothiadiazol-4-yl)-3-[(2-bromophenyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 46393977 |
| Molecular Formula | C19H13BrN4O3S2 |
| Molecular Weight | 489.38 g/mol |
| Exact Mass | 487.96 |
| IUPAC Name | N-(2,1,3-benzothiadiazol-4-yl)-3-[(2-bromophenyl)sulfonylamino]benzamide |
| SMILES | O=C(Nc1cccc2nsnc12)c1cccc(NS(=O)(=O)c2ccccc2Br)c1 |
| InChI | InChI=1S/C19H13BrN4O3S2/c20-14-7-1-2-10-17(14)29(26,27)24-13-6-3-5-12(11-13)19(25)21-15-8-4-9-16-18(15)23-28-22-16/h1-11,24H,(H,21,25) |
| InChIKey | FPZZDUZKUZIFGF-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.38 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |